| Cas No.: | 2097938-74-2 |
| Chemical Name: | 4-((2-(4-((4-phenoxyphenyl)carbamoyl)phenoxy)acetamido)methyl)-1,2-phenylene bis(dihydrogen phosphate) |
| Synonyms: | Stafib 2 |
| SMILES: | O=C(NC1=CC=C(OC2=CC=CC=C2)C=C1)C3=CC=C(OCC(NCC4=CC=C(OP(O)(O)=O)C(OP(O)(O)=O)=C4)=O)C=C3 |
| Formula: | C28H26N2O12P2 |
| M.Wt: | 644.466 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Stafib-2 (Stafib 2) is a potent, selective small molecule inhibitor of transcription factor STAT5b with Ki of 9 nM, >20-fold selectivity over STAT5a. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
