| Cas No.: | 2113664-14-3 |
| Chemical Name: | UKH-1114 |
| SMILES: | C1=C(C=CC(C(F)(F)F)=C1)C1C=C2C3N(CCCO)CCCC(C3)C2=CC=1 |
| Formula: | C22H24F3NO |
| M.Wt: | 375.427276611328 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | UKH-1114 (UKH1114) is a potent, sigma 2 receptor/Tmem97 agonist with Ki of 46 nM; displays high selectivity for σ2R/Tmem97 versus >50 other proteins, including 5-HT receptors; relieves spared nerve injury-induced mechanical hypersensitivity without producing any motor impairment. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
