| Cas No.: | 885898-58-8 |
| Chemical Name: | (1-Benzyl-1H-indol-3-ylmethyl)-pyridin-3-yl-amine |
| Synonyms: | (1-Benzyl-1H-indol-3-ylmethyl)-pyridin-3-yl-amine |
| SMILES: | C1=CC=C(NCC2=CN(CC3=CC=CC=C3)C3=CC=CC=C23)C=N1 |
| Formula: | C21H19N3 |
| M.Wt: | 313.396 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | VA-012 is a potent, selective 5-HT2C receptor positive allosteric modulator (PAM) that exhibits dose-dependent potentiation of 5-HT efficacy with EC50 of 16 nM; shows no significant off-target activities, and low binding competition with serotonin or other orthosteric ligands; increases the anorectic effect combined with the SSRI sertraline; reduces food intake and body weight gain without causing CNS-related malaise. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
