| Cas No.: | 1244967-98-3 |
| Chemical Name: | 4-(1-methyl-1H-pyrrole-2-carbonyl)-N-{4-[4-(morpholine-4-carbonyl)piperidin-1-yl]phenyl}piperazine-1-carboxamide |
| Synonyms: | Pizuglanstat |
| SMILES: | O=C(NC1C=CC(N2CCC(C(=O)N3CCOCC3)CC2)=CC=1)N1CCN(C(=O)C2N(C)C=CC=2)CC1 |
| Formula: | C27H36N6O4 |
| M.Wt: | 508.61 |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Pizuglanstat is a potent, selective prostaglandin D synthase inhibitor. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
