| Cas No.: | 2313525-90-3 |
| Chemical Name: | 2-oxo-5-phenyl-N-[2-[4-[5-(trifluoromethyl)pyridin-2-yl]oxyphenyl]ethyl]pentanamide |
| Synonyms: | LEI110;BDBM50544595;2-oxo-5-phenyl-N-[2-[4-[5-(trifluoromethyl)pyridin-2-yl]oxyphenyl]ethyl]pentanamide |
| SMILES: | FC(C1=CN=C(C=C1)OC1C=CC(=CC=1)CCNC(C(CCCC1C=CC=CC=1)=O)=O)(F)F |
| Formula: | C25H23F3N2O3 |
| M.Wt: | 456.456937074661 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | LEI110 (LEI-110) is a potent Phospholipase A2 group XVI (PLA2G16) inhibitor with Ki of 20 nM, also has activity on HRASLS2, RARRES3 and iNAT (pIC50=6.8-7.6); reduces cellular arachidonic acid levels and oleic acid-induced lipolysis in human HepG2 cells; LEI110 is a selective pan-inhibitor of the HRASLS-family of thiol hydrolases (i.e. PLA2G16, HRASLS2, RARRES3 and iNAT). |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
