| Cas No.: | 184475-71-6 |
| Chemical Name: | 6-Quinazolinol, 4-[(3-chloro-4-fluorophenyl)amino]-7-methoxy- |
| SMILES: | ClC1=C(F)C=CC(NC2C3C(=CC(OC)=C(O)C=3)N=CN=2)=C1 |
| Formula: | C15H11ClFN3O2 |
| M.Wt: | 319.7181 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | A metabolite of Gefitinib, which is a potent inhibitor of tyrosine phosporylation in EGFR. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
