| Cas No.: | 1405-37-4 |
| Chemical Name: | Capreomycin, sulfate (salt) |
| SMILES: | NCCC[C@@H](C(NC[C@@H]1NC(=O)[C@H](CO)NC(=O)[C@@H](N)CNC(=O)[C@H](C2CCN=C(N)N2)NC(=O)/C(=C/NC(=O)N)/NC1=O)=O)N.OS(=O)(O)=O |
| Formula: | C25H46N14O11S |
| M.Wt: | 750.7849 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | A peptide antibiotic, commonly grouped with the aminoglycosides, which is given in combination with other antibiotics for MDR-tuberculosis. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
