| Cas No.: | 104723-60-6 |
| Chemical Name: | β-Cyclodextrin, O-α-D-glucopyranosyl-(1→4)-O-α-D-glucopyranosyl-(1→6A)- |
| Synonyms: | Mal-βCD |
| SMILES: | [C@@H]12[C@H](O)[C@H]([C@@H](O[C@H]3[C@H](O)[C@H]([C@@H](O[C@H]4[C@H](O)[C@H]([C@@H](O[C@H]5[C@H](O)[C@H](C(O[C@@H]5CO)O[C@H]5[C@H](O)[C@@H](O)[C@H](O[C@@H]5CO)O[C@H]5[C@H](O)[C@@H](O)[C@H](O[C@@H]5CO)O[C@H]5[C@H](O)[C@@H](O)[C@H](O[C@@H]5CO)O1)O)O[C@@H]4CO)O)O[C@@H]3CO)O)O[C@@H]2CO[C@@H]1[C@H](O)[C@H]([C@H](O[C@@H]2[C@H](O)[C@H]([C@H](O)[C@@H](CO)O2)O)[C@@H](CO)O1)O)O |
| Formula: | C54H90O45 |
| M.Wt: | 1459.265 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | A cellular cholesterol modifier that can form soluble inclusion complex with cholesterol; shows much less cytotoxicity to human erythrocytes and Caco-2 cells; a cyclodextrin derivative. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
