| Cas No.: | 163269-30-5 |
| Chemical Name: | 1,4,2-Oxathiazine, 3-benzo[b]thien-2-yl-5,6-dihydro-, 4-oxide |
| SMILES: | S1C(C2S(=O)CCON=2)=CC2C=CC=CC1=2 |
| Formula: | C11H9NO2S2 |
| M.Wt: | 251.3247 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | A new broad spectrum industrial microbicide with applications in material and coating preservation. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
