| Cas No.: | 122852-42-0 |
| Chemical Name: | 1H-Pyrido[4,3-b]indol-1-one, 2,3,4,5-tetrahydro-5-methyl-2-[(4-methyl-1H-imidazol-5-yl)methyl]- |
| Synonyms: | GR-68755X;GR-68755 |
| SMILES: | Cc1c(ncn1)CN2C(=O)c3c4c(cccc4)n(C)c3CC2 |
| Formula: | C17H18N4O |
| M.Wt: | 294.351 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | A potent and selective 5-HT3 receptor antagonist has been shown to be beneficial in the treatment of irritable bowel syndrome.Irritable Bowel SyndromeApproved |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
