| Cas No.: | 362665-56-3 |
| Chemical Name: | Piperidine, 1-[3-[3-(4-chlorophenyl)propoxy]propyl]- |
| Synonyms: | Tiprolisant;BF-2649;BF 2.649 |
| SMILES: | ClC1=CC=C(CCCOCCCN2CCCCC2)C=C1 |
| Formula: | C17H26ClNO |
| M.Wt: | 295.8474 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | A potent and selective antagonist of H3 receptor with Ki/EC50 of 0.16/1.5 nM; no effect on H1, H2, H4 receptors (IC50>10 uM); orally bioactive.Sleep DisorderApproved |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
