| Cas No.: | 935776-74-2 |
| Chemical Name: | N-[1-[(3,4-Difluorophenyl)methyl]-4-piperidinyl]-6-(trifluoromethyl)-3-pyridazinamine |
| Synonyms: | JNJ37822681 |
| SMILES: | FC1=C(F)C=CC(=C1)CN2CCC(CC2)NC3N=NC(=CC=3)C(F)(F)F |
| Formula: | C17H17F5N4 |
| M.Wt: | 372.34 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | JNJ-37822681 is a potent, specific and fast-dissociating dopamine D2 antagonist with Ki of 158 nM; shows no significant affinity for α1, α2, H1, muscarinic, and 5-HT2C receptors, D1, D3, and 5-HT2A; exhibits potential therapeutic value for the treatment of schizophrenia and bipolar disorder with optimal brain disposition.SchizophreniaPhase 2 Clinical |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
