| Cas No.: | 25614-03-3 |
| Synonyms: | 2-Bromoergocriptine |
| SMILES: | CC(C[C@H]1C(=O)N2CCC[C@H]2[C@]2(O)O[C@@](C(=O)N12)(C(C)C)NC([C@H]1CN(C)[C@H]2C(c3cccc4c3c(C2)c([nH]4)Br)=C1)=O)C |
| Formula: | C32H40BrN5O5 |
| M.Wt: | 654.59 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Bromocriptine (2-Bromoergocriptine;Parlodel) is an ergoline derivative and dopamine agonist with Ki of 2.96 and 5.42 nM for D2 and D3, also shows affinity for various serotonin receptors and 5-HT receptors. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
