| Cas No.: | 86784-80-7 |
| Chemical Name: | Corticotropin-releasing factor (human) |
| Synonyms: | CRF (HUMAN, RAT);Corticotropin Releasing Factor human, rat;Corticotropin-releasing factor (human);Corticotropin-releasing Factor (Human, rat);CORTICOTROPIN-RELEASING FACTOR(CRF), HUMAN, RAT;CRF (human, rat) Acetate;CRF (human, rat), CRF-41, CRH, Corticoliberin, Corticorelin;Human corticotropin-releasing factor;Human CRF;Corticotropin-releasing factor (human and rat);Human CRF(1-41);Human corticotropin-releasing hormone-41;Rat;Rat/human corticotropin-releasing factor;CORTICOTROPIN RELEASING FACTOR;CORTICOTROPIN RELEASING FACTOR (CRF), HUMAN, RAT;CORTICOTROPIN RELEASING FACTOR, HUMAN;CORTICOTROPIN RELEASING FACTOR, HUMAN AND RAT;CORTICOTROPIN RELEASING FACTOR HUMAN, RAT;CRF, HUMAN AND RAT;CRH |
| SMILES: | [H]/N=C(/NCCCC(C(NC(C(NC(C(NC(C(NC(C(NC(C(NC(C(=O)O)C(CC)C)=O)C(CC)C)=O)CCC(=O)O)=O)CC(C)C)=O)CCSC)=O)CCCCN)=O)NC(C(NC(C(NC(C(NC(C(NC(C(NC(C(NC(C(NC(C(NC(C(NC(C(NC(C(NC(C(NC(C(NC(C(NC(C(NC(C(NC(C(C(C)C)NC(C(NC(C(NC(C(NC(C(NC(C(NC(C(NC(C(C(O)C)NC(C(NC(C(NC(C(NC(C(NC(C(C(CC)C)NC(C1N(C(C2N(C(C(NC(C(NC(C(CO)N)=O)CCC(=O)O)=O)CCC(=O)O)=O)CCC2)=O)CCC1)=O)=O)CO)=O)CC(C)C)=O)CC(=O)O)=O)CC(C)C)=O)=O)CC1=CC=CC=C1)=O)CC1N=CNC=1)=O)CC(C)C)=O)CC(C)C)=O)CCCN/C(=N/[H])/N)=O)CCC(=O)O)=O)=O)CC(C)C)=O)CCC(=O)O)=O)CCSC)=O)C)=O)CCCN/C(=N/[H])/N)=O)C)=O)CCC(=O)O)=O)CCC(=O)N)=O)CC(C)C)=O)C)=O)CCC(=O)N)=O)CCC(=O)N)=O)C)=O)CC1N=CNC=1)=O)CO)=O)CC(=O)N)=O)\N |
| Formula: | C208H343N59O64S2 |
| M.Wt: | 4758.43596577644 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Corticotropin-releasing hormone (CRH) is a peptide hormone involved in the stress response. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
