| Cas No.: | 226700-81-8 |
| Chemical Name: | Carbamic acid, N-[(1S,2R)-3-[[(4-aminophenyl)sulfonyl](2-methylpropyl)amino]-1-(phenylmethyl)-2-(phosphonooxy)propyl]-, (3S)-tetrahydro-3-furanyl ester, calcium salt (1:1) |
| Synonyms: | GW-433908;GW-433908G |
| SMILES: | CC(C)CN(C[C@@H](OP([O-])([O-])=O)[C@@H](NC(O[C@@H]1COCC1)=O)CC1=CC=CC=C1)S(C1=CC=C(N)C=C1)(=O)=O.[Ca+2] |
| Formula: | C25H34CaN3O9PS |
| M.Wt: | 623.6689 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | A phosphate ester prodrug of the HIV-1 protease inhibitor amprenavir with improved solubility.HIV InfectionApproved |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
