| Cas No.: | 864863-72-9 |
| Chemical Name: | Quinoline, 6-[1-(2-fluoro-3-pyridinyl)-5-methyl-1H-1,2,3-triazol-4-yl]- |
| SMILES: | FC1=C(N2C(C)=C(C3C=CC4N=CC=CC=4C=3)N=N2)C=CC=N1 |
| Formula: | C17H12FN5 |
| M.Wt: | 305.3091 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | A potent, specific and allosteric mGluR1 antagonist with IC50 of 6 nM and 1.4 nM for human and mouse mGluR1, respectively. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
