| Cas No.: | 1905481-36-8 |
| Chemical Name: | Cyclopropanecarboxamide, N-[(3R)-1-[[5-(1-methylethyl)-1H-pyrazol-3-yl]carbonyl]-3-pyrrolidinyl]- |
| SMILES: | O=C(NC1CN(C(=O)C2NN=C(C(C)C)C=2)CC1)C1CC1 |
| Formula: | C15H22N4O2 |
| M.Wt: | 290.3608 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | An inhibitor of histone demethylase. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
