| Cas No.: | 1629268-19-4 |
| Chemical Name: | 2-Propen-1-one, 1-[4-[(2',5',6-trichloro-4-methoxy[1,1'-biphenyl]-3-yl)carbonyl]-1-piperazinyl]- |
| SMILES: | ClC1=C(C2C(Cl)=CC=C(Cl)C=2)C=C(C(=O)N2CCN(C(=O)C=C)CC2)C(OC)=C1 |
| Formula: | C21H19Cl3N2O3 |
| M.Wt: | 453.7462 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | A novel and irreversible inhibitor of mutant K-ras G12C. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
