| Cas No.: | 133718-29-3 |
| Chemical Name: | Acetamide, N-cyclohexyl-N-methyl-2-[[(E)-[phenyl(1,2,3,5-tetrahydro-2-oxoimidazo[2,1-b]quinazolin-7-yl)methylene]amino]oxy]- |
| Synonyms: | R 80122;R80122;R-80122 |
| SMILES: | C1(N(C)C(=O)CO/N=C(\C2C=CC=CC=2)/C2=CC=C3C(CN4CC(=O)NC4=N3)=C2)CCCCC1 |
| Formula: | C26H29N5O3 |
| M.Wt: | 459.5402 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | A potent, selective PDE3 inhibitor with IC50 of 36 nM, displays >20,000-fold selectivity over PDE1. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
