| Cas No.: | 81732-65-2 |
| Chemical Name: | Carbamic acid, N,N-dimethyl-, C,C'-[5-[2-[(1,1-dimethylethyl)amino]-1-hydroxyethyl]-1,3-phenylene] ester |
| Synonyms: | (±)-Bambuterol |
| SMILES: | CN(C(OC1=CC(OC(N(C)C)=O)=CC(C(CNC(C)(C)C)O)=C1)=O)C |
| Formula: | C18H29N3O5 |
| M.Wt: | 367.44 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | A long acting beta-adrenoceptor agonist (LABA) used in the treatment of asthma; also is a prodrug of terbutaline.AsthmaApproved |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
