| Cas No.: | 869185-85-3 |
| Chemical Name: | Pyridine, 4-[4-(4-fluorophenyl)-2-[4-(methylsulfinyl)phenyl]-1H-imidazol-5-yl]-, hydrochloride (1:1) |
| Synonyms: | RWJ 64809 hydrochloride;SB203580 hydrochloride;SB-203580 hydrochloride |
| SMILES: | O=S(C)C1C=CC(C2NC(C3C=CN=CC=3)=C(C3C=CC(F)=CC=3)N=2)=CC=1.[H]Cl |
| Formula: | C21H17ClFN3Os |
| M.Wt: | 413.8956 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | A specific p38 MAPK inhibitor with IC50 of 0.6 uM; shows selectivity over JNK, p42 MAPK, p90 S6K, p70 S6K, PKA, etc.; suppresses the activation of MAPKAP kinase-2 and prevents the phosphorylation of HSP27 in response to interleukin-1, cellular stresses and bacterial endotoxin in vivo. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
