| Cas No.: | 157752-20-0 |
| Chemical Name: | (1S,5R,8E)-8-benzylidene-5-(3-hydroxyphenyl)-2-methyl-2-azabicyclo[3.3.1]nonan-7-one |
| Synonyms: | CB 64D;CB64D |
| SMILES: | C1=CC=C(C=C1)\C=C2C3CC(CC\2=O)(CCN3C)C4=CC(O)=CC=C4 |
| Formula: | C22H23NO2 |
| M.Wt: | 333.431 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | A potent, selective sigma-2 receptor agonist with Ki of 16.5 nM, 200-fold selectivity over sigma 1 (Ki=3063 nM); significantly induces the calcium signal and cell death in SK-N-SH cells, produces dose-dependent cytotoxicity, induces apoptosis in MCF-7 and T47D breast tumor cell lines. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
