| Cas No.: | 37517-30-9 |
| Chemical Name: | N-[3-Acetyl-4-[2-hydroxy-3-[(1-methylethyl)amino]propoxy]phenyl]butanamide |
| SMILES: | C(C1=C(OCC(O)CNC(C)C)C=CC(NC(=O)CCC)=C1)(=O)C |
| Formula: | C18H28N2O4 |
| M.Wt: | 336.426 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | A cardioselective beta blocker for the treatment of hypertension and arrhythmias.HypertensionApproved |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
