| Cas No.: | 82413-20-5 |
| Chemical Name: | (Z)-4-(1-(4-(2-aminoethoxy)phenyl)-2-phenylbut-1-en-1-yl)phenol |
| Synonyms: | 3-Hydroxytamoxifen;FK-435 |
| SMILES: | CN(CCOC1C=CC(/C(=C(\C2C=CC=CC=2)/CC)/C2C=CC=C(O)C=2)=CC=1)C |
| Formula: | C26H29NO2 |
| M.Wt: | 387.52 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | A nonsteroidal selective estrogen receptor modulator (SERM) that shows 10- to 60-fold increased affinity for the estrogen receptor compared with Tamoxifen; has reduced partial estrogen agonistic activity.Breast CancerPhase 2 Clinical |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
