| Cas No.: | 133825-81-7 |
| Chemical Name: | 1-(2,6-diisopropylphenyl)-3-((1-(4-(dimethylamino)phenyl)cyclopentyl)methyl)urea hydrochloride |
| Synonyms: | PD-132301;PD132301-2;ATR 101;Nevanimibe |
| SMILES: | Cl.CN(C)C1=CC=C(C=C1)C2(CCCC2)CNC(=O)NC3=C(C=CC=C3C(C)C)C(C)C |
| Formula: | C27H40ClN3O |
| M.Wt: | 458.09 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | ATR-101 (PD-132301, Nevanimibe) is a selective and potent inhibitor of ACAT1 with IC50 of 52 nM; induces H295R cell apoptosis, causes mitochondrial hyperpolarization, reactive oxygen release, and ATP depletion, caspase-3/7 activation, and membrane permeabilization; decreases the formation of cholesteryl esters and increases FC levels in H295R adrenocortical carcinoma cells; inhibits the establishment and impeds the growth of ACC-derived H295R cell xenografts in mice; orally active. Cushing Disease Phase 2 Clinical |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
