| Cas No.: | 2226201-97-2 |
| Chemical Name: | 2-chloro-N-(2-((4-(methyl(4-phenylbutyl)amino)-6-(prop-2-yn-1-ylamino)-1,3,5-triazin-2-yl)amino)ethyl)acetamide |
| Synonyms: | PDIA1 inhibitor KSC-34 |
| SMILES: | O=C(NCCNC1=NC(N(C)CCCCC2=CC=CC=C2)=NC(NCC#C)=N1)CCl |
| Formula: | C21H28ClN7O |
| M.Wt: | 429.95 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | KSC-34 (PDIA1 inhibitor KSC-34) is a potent, selective protein disulfide isomerase A1 (PDIA1) inhibitor, 30-fold selectivity for the A-site over the A' site; displays time-dependent inhibition of PDIA1 reductase activity in vitro with a kinact/ KI of 9.66 × 103 M-1 s-1 and is selective for PDIA1 over other members of the PDI family, and other cellular cysteine-containing proteins; significantly decreases the rate of secretion of a destabilized, amyloidogenic antibody light chain, thereby minimizing pathogenic amyloidogenic extracellular proteins in treated cells. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
