| Cas No.: | 1353016-71-3 |
| Chemical Name: | Dibenz[b,f]azocine-5(6H)-butanoic acid,11,12-didehydro-γ-oxo-,2,5-dioxo-1-pyrrolidinyl es |
| Synonyms: | DBCO NHS ester |
| SMILES: | O=C(N1CC2=CC=CC=C2C#CC2=CC=CC=C12)CCC(ON1C(=O)CCC1=O)=O |
| Formula: | C25H22N2O5 |
| M.Wt: | 430.45 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | An amine-reactive NHS ester that provides easy attachment of the reactive moiety to almost any primary or secondary amine group, such as that of protein, peptide, or small molecule amine; A click chemistry tool used to conjugate DBCO-PEG4-MMAF to the introduced non-natural amino acid pAMF using a noncleavable linker. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
