| Cas No.: | 712325-30-9 |
| Chemical Name: | 2-((1-Bromonaphthalen-2-yl)oxy)-N-(pyridin-3-yl)acetamide |
| Synonyms: | VU 0405601;VU-0405601 |
| SMILES: | O=C(COC1C=CC2=CC=CC=C2C=1Br)NC1=CC=CN=C1 |
| Formula: | C17H13BrN2O2 |
| M.Wt: | 357.207 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | A potent Kv11.1 (hERG) channel allosteric modulator that protects cardiac tissue from hERG-related drug-induced arrhythmias; increases the IC(50) of dofetilide from 38.7 to 76.3 nM, mitigates the effects of hERG blockers from the extracellular aspect primarily by reducing inactivation; reduces the sensitivity of hERG to inhibitors. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
