| Cas No.: | 927691-21-2 |
| Chemical Name: | 6,7-Dimethoxy-4-[(3r)-3-(2-quinoxalinyloxy)-1-pyrrolidinyl]quinazoline |
| Synonyms: | 6,7-Dimethoxy-4-[(3r)-3-(2-quinoxalinyloxy)-1-pyrrolidinyl]quinazoline;6,7-dimethoxy-4-(3-quinoxalin-2-yloxypyrrolidin-1-yl)quinazoline;6,7-Dimethoxy-4-[(3R)-3-(2-quinoxalinyloxy)-1-pyrrolidinyl]-quinazoline;PQ 10 |
| SMILES: | COC1=C(C=C2C(=C1)C(=NC=N2)N3CC[C@H](C3)OC4=NC5=CC=CC=C5N=C4)OC |
| Formula: | C22H21N5O3 |
| M.Wt: | 403.434 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | A potent, selective, brain penetrant PDE10A inhibitor with Ki of 4 nM; displays 53-fold and 68-fold selectivity over PDE3A and PDE3B, respectively; selectively inhibits colon tumor cell growth with IC50 of 0.1-28 uM; selectively activates cGMP/cGMP-dependent protein kinase signaling to suppress β-catenin levels and T-cell factor (TCF) transcriptional activity in colon tumor cells. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
