| Cas No.: | 1228357-04-7 |
| Chemical Name: | 3-(((3-(Trifluoromethyl)phenoxy)carbonyl)amino)propane-1,2-diyl bis(3,4,5-trihydroxybenzoate) |
| Synonyms: | 3-(((3-(trifluoromethyl)phenoxy)carbonyl)amino)propane-1,2-diyl bis(3,4,5-trihydroxybenzoate);CDE-096;[3-[[3-(trifluoromethyl)phenoxy]carbonylamino]-2-(3,4,5-trihydroxybenzoyl)oxypropyl] 3,4,5-trihydroxybenzoate;GLXC-04309;1228357-04-7;CS-0078249;1-({[3-(trifluoromethyl)phenoxy]carbonyl}amino)-3-(3,4,5-trihydroxybenzoyloxy)propan-2-yl 3,4,5-trihydroxybenzoate;OXWKLJPAKUDPJY-UHFFFAOYSA-N;EX-A5191;AKOS040746678;HY-120516;SCHEMBL13286848;3-(((3-(Trifluoromethyl)phenoxy)carbonyl)amino)-propane-1,2-diyl bis(3,4,5-trihydroxybenzoate) |
| SMILES: | FC(C1C=CC=C(C=1)OC(NCC(COC(C1C=C(C(=C(C=1)O)O)O)=O)OC(C1C=C(C(=C(C=1)O)O)O)=O)=O)(F)F |
| Formula: | C25H20F3NO12 |
| M.Wt: | 583.421018600464 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | A selective, reversible, high-affinity PAI-1 inhibitor that prevents PAI-1 from inactivating tPA and uPA with similar potency (IC50=30 and 25 nM, respectively); shows ineffective against two closely related serpins, antithrombin and α1-PI; blocks PAI-1 binding to vitronectin with IC50 of 22 nM. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
