| Cas No.: | 505056-50-8 |
| Chemical Name: | N-(5-methylisoxazol-3-yl)-2-[4-(thiophen-2-yl)-6-(trifluoromethyl)pyrimidin-2-ylthio]acetamide |
| Synonyms: | Hsp90α inhibitor CP-9 |
| SMILES: | CC1ON=C(NC(CSC2N=C(C3=CC=CS3)C=C(C(F)(F)F)N=2)=O)C=1 |
| Formula: | C15H11F3N4O2S2 |
| M.Wt: | 400.394 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | A potent Hsp90α/p23 interaction inhibitor with IC50 of 3.2 uM; 5-fold less potent for Hsp90β/p23 interaction (IC50=15.3 uM); leads to various levels of degradation of pAkt/total Akt and Raf-1 in cancer cell lines, but has no effect on the expression of the Hsp90 client proteins in normal mouse embryonic fibroblasts (MEFs); inhibits cell proliferation, glucose metabolism, and mammalian thymidine kinase activities in multiple cancer cell lines. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
