| Cas No.: | 150374-95-1 |
| Chemical Name: | Propanoic acid, 2,2-dimethyl-, 4-[[[2-[[(carboxymethyl)amino]carbonyl]phenyl]amino]sulfonyl]phenyl ester, sodium salt (1:1) |
| Synonyms: | EI-546;LY-544349;ONO-5046 |
| SMILES: | [Na+].O=C(CNC(C1=CC=CC=C1NS(C1C=CC(OC(C(C)(C)C)=O)=CC=1)(=O)=O)=O)[O-] |
| Formula: | C20H21N2NaO7S |
| M.Wt: | 456.4447 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | A potent, specific and competitive inhibitor of human neutrophil elastase with IC50 of 44 nM; also inhibits leukocyte elastase obtained from rabbit, rat, hamster and mouse, do not inhibit trypsin, thrombin, plasmin, plasma kallikrein, pancreas kallikrein, chymotrypsin and cathepsin G (>10 uM); attenuates LPS-induced acute lung inflammation in the hamster.Other IndicationApproved |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
