| Cas No.: | 1799948-06-3 |
| Chemical Name: | Benzonitrile, 3-[[(3R)-4-(difluoromethyl)-2,2-difluoro-2,3-dihydro-3-hydroxy-1,1-dioxidobenzo[b]thien-5-yl]oxy]-5-fluoro- |
| SMILES: | N#CC1C=C(OC2C(C(F)F)=C3C(C(S(=O)(=O)C3=CC=2)(F)F)O)C=C(F)C=1 |
| Formula: | C16H8F5NO4S |
| M.Wt: | 405.2961 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | A potent HIF-2α inhibitor with IC50 of <500 nM in HIF-2α scintillation proximity assay. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
