| Cas No.: | 53185-12-9 |
| Chemical Name: | 3,4-Piperidinediol, 2-(hydroxymethyl)-, (2R,3R,4R)- |
| Synonyms: | Fagomine |
| SMILES: | OC[C@H]1NCC[C@@H](O)[C@@H]1O |
| Formula: | C6H13NO3 |
| M.Wt: | 147.1723 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | D-Fagomine (Fagomine) is a a mild glycosidase inhibitor, inhibits Amyloglucosidase (A.niger), β-Glucosidase (bovine), and Isomaltase (yeast) with Ki of 4.8 uM, 39 uM, and 70 uM, respectively; counteracts the short-term effects of a high-energy-dense diet on body weight, fasting blood glucose levels and the proportion of gut Enterobacteriales, reduces the amount of Enterobacteriales excreted by rats fed HFHS. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
