| Cas No.: | 173997-05-2 |
| Chemical Name: | 2H-Imidazole-2-thione, 5-(aminomethyl)-1-[(2S)-5,7-difluoro-1,2,3,4-tetrahydro-2-naphthalenyl]-1,3-dihydro- |
| Synonyms: | SYN117;RS-25560-197;SYN-117;SYN 117 |
| SMILES: | NCC1N(C(=S)NC=1)C2CC3C(CC2)=C(F)C=C(F)C=3 |
| Formula: | C14H15F2N3S |
| M.Wt: | 295.3508 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks4°C in DMSO,6 months-80°C in DMSO |
| Description: | Nepicastat (RS-25560-197, SYN-117) is a potent, selective, orally active inhibitor of dopamine-beta-hydroxylase (DBH) with IC50 of 8.5 and 9.0 nM for bovine and human DBH, respectively; Nepicastat is 2-3 fold more potent than the corresponding R-enantiom |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
