| Cas No.: | 98224-03-4 |
| Chemical Name: | Piperazine, 1-(2,3-dihydro-1,4-benzodioxin-5-yl)- |
| Synonyms: | DU-28853 |
| SMILES: | Cl.O1CCOC2C(N3CCNCC3)=CC=CC1=2 |
| Formula: | C12H16N2O2 |
| M.Wt: | 220.2676 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | An antiaggressive agent that acts as an agonist at the 5-HT1A and 5-HT1B receptors and as an antagonist at the 5-HT2C receptor.SchizophreniaPhase 2 Clinical |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
