| Cas No.: | 1383718-29-3 |
| Chemical Name: | NecroX-5 |
| Synonyms: | NecroX-5;NecroX-5 mesylate;5-[(1,1-Dioxido-4-thiomorpholinyl)methyl]-2-phenyl-N-[(tetrahydro-2H-pyran-4-yl)methyl]-1H-indol-7-amine dimesylate;Necrox-5 (methanesulfonate);5-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-N-(oxan-4-ylmethyl)-2-phenyl-1H-indol-7-amine;methanesulfonic acid |
| SMILES: | S1(CCN(CC2C=C3C=C(C4C=CC=CC=4)NC3=C(C=2)NCC2CCOCC2)CC1)(=O)=O.S(C)(=O)(=O)O.S(C)(=O)(=O)O |
| Formula: | C27H39N3O9S3 |
| M.Wt: | 645.808264017105 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | NecroX-5 is a novel necroptosis inhibitor that reduces mitochondrial oxidative stress, prevents hypoxia/reoxygenation injury by inhibiting the mitochondrial calcium uniporter; improves mitochondrial oxygen consumption, and suppresses mitochondrial Ca(2+) overload during reoxygenation in an in vitro rat heart HR model, reduces the ouabain- or histamine-induced increase in mitochondrial Ca(2+). |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
