| Cas No.: | 922150-11-6 |
| Chemical Name: | SCH529074 |
| Synonyms: | SCH 529074;N1-(2-((4-(bis(4-chlorophenyl)methyl)piperazin-1-yl)methyl)quinazolin-4-yl)-N3,N3-dimethylpropane-1,3-diamine;N3-[2-[[4-[Bis(4-chlorophenyl)methyl]-1-piperazinyl]methyl]-4-quinazolinyl]-N1,N1-dimethyl-1,3-propanediamine (ACI);Sch 529074;SCH529074 |
| SMILES: | ClC1C=CC(C(N2CCN(CC3N=C(NCCCN(C)C)C4C(=CC=CC=4)N=3)CC2)C2C=CC(Cl)=CC=2)=CC=1 |
| Formula: | C31H36Cl2N6 |
| M.Wt: | 563.563744544983 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | SCH 529074 is a small molecule mutant p53 reactivator that binds p53 DNA binding domain with Kd of 1-2 uM; restores growth-suppressive function to mutant p53 and inhibits ubiquitination of p53 by HDM2. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
