| Cas No.: | 78824-30-3 |
| Chemical Name: | 3-(3,4-dihydroxybenzoyl)-4-hydroxy-8,8-dimethyl-1,7-bis(3-methyl-2-buten-1-yl)-5-[(2S)-5-methyl-2-(1-methylethenyl)-4-hexen-1-yl]-bicyclo[3.3.1]non-3-ene-2,9-dione |
| Synonyms: | Camboginol |
| SMILES: | C/C(=C/C[C@@H](C[C@@]12C[C@@H](C/C=C(\C)/C)C(C)(C)[C@@](C/C=C(\C)/C)(C(/C(/C1=O)=C(\C1C=CC(O)=C(O)C=1)/O)=O)C2=O)C(=C)C)/C |
| Formula: | C38H50O6 |
| M.Wt: | 602.812 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Garcinol (Camboginol) is a potent, natural inhibitor of histone acetyltransferases (HATs) p300 (IC50=7 uM) and PCAF (IC50=5 uM) both in vitro and in vivo; downregulates various cell survival proteins including survivin, bcl-2, XIAP, and cFLIP, and induces bid cleavage, bax, and cytochrome c release, potentiates TRAIL-induced apoptosis through upregulation of death receptors and downregulation of antiapoptotic proteins; also siimulates neurogenesis and ex vivo expansion of human hematopoietic stem cells. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
