| Cas No.: | 59338-93-1 |
| Chemical Name: | 6-Methoxy-N-[[1-(2-propenyl)-2-pyrrolidinyl]methyl]-1H-benzotriazole-5-carboxamide |
| Synonyms: | MS 5080 |
| SMILES: | C(N1CCCC1CNC(C1C(OC)=CC2NN=NC=2C=1)=O)C=C |
| Formula: | C16H21N5O2 |
| M.Wt: | 315.377 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Alizapride (MS 5080) is a dopamine D2 antagonist with prokinetic and antiemetic effects used in the treatment of nausea and vomiting. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
