| Cas No.: | 145231-35-2 |
| Chemical Name: | Clobenpropit HBr |
| Synonyms: | VUF-9153;VUF9153 |
| SMILES: | Br.Br.N/C(=N/CC1C=CC(Cl)=CC=1)/SCCCC1=CN=CN1 |
| Formula: | C14H19Br2ClN4S |
| M.Wt: | 470.652 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Clobenpropit (VUF-9153) is a highly potent histamine H3 antagonist/inverse agonist with pA2 value of 9.93, also displays partial agonist activity at H4 receptors; increases brain histidine decarboxylase activity dose dependently, inhibits electrically induced convulsions in mice. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
