| Cas No.: | 177945-46-9 |
| Chemical Name: | 4-(4-fluorophenil)-1,2,3,6- tetrahydro-1-[4-(1,2,4-triazol-1-il)butyl] pyridine citrate |
| Synonyms: | E5842 |
| SMILES: | FC1=CC=C(C=C1)C2=CCN(CCCCN3N=CN=C3)CC2 |
| Formula: | C17H21FN4 |
| M.Wt: | 300.381 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | E-5842 is a preferential sigma-1 receptor ligand, demonstrates potential atypical antipsychotic effects in vivo; increases phospholipase C (PLC) activity in the striatum and the hippocampus, increased levels of Fos in the medial prefrontal cortex and the nucleus accumbens in rat forebrain. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
