| Cas No.: | 909725-61-7 |
| Chemical Name: | W146 |
| Synonyms: | [(3R)-3-aMino-4-[(3-hexylphenyl)aMino]-4-oxobutyl]-phosphonic acid;[(3R)-3-amino-4-(3-hexylanilino)-4-oxobutyl]phosphonic acid;W146;W146HYDRATE |
| SMILES: | O=C(NC1=CC=CC(CCCCCC)=C1)[C@H](N)CCP(O)(O)=O |
| Formula: | C16H27N2O4P |
| M.Wt: | 342.37038 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | W146 is a potent, selective S1P1 antagonist with Ki of 18 nM, displays no effect at S1P2, S1P3 or S1P5, enhances capillary leakage and restores lymphocyte egress in vivo. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
