| Cas No.: | 1222088-90-5 |
| Chemical Name: | (1R,2R)-6'-((2-((R)-2,2-dimethylcyclopentyl)-2'-fluoro-5'-methoxy-[1,1'-biphenyl]-4-yl)methoxy)-2',3'-dihydrospiro[cyclopropane-1,1'-indene]-2-carboxylic acid |
| Synonyms: | AM5262 |
| SMILES: | CC1(C)C(C2=C(C3=C(F)C=CC(OC)=C3)C=CC(COC3=CC4C5(C(C(O)=O)C5)CCC=4C=C3)=C2)CCC1 |
| Formula: | C33H35FO4 |
| M.Wt: | 514.637 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | AM-5262 is a potent full GPR40 (FFA1) agonist with EC50 of 81 nM; shows improved rat PK profile and general selectivity profile, enhances glucose stimulated insulin secretion (mouse and human islets) and improves glucose homeostasis in vivo (OGTT in HF/STZ mice) when compared to AM-1638. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
