| Cas No.: | 936234-43-4 |
| Chemical Name: | (2S)-2-amino-4-{hydroxy[hydroxy(4-hydroxy-3-methoxy-5-nitrophenyl)methyl]phosphoryl}butanoic acid |
| SMILES: | COC1=C(O)C([N+](=O)[O-])=CC(=C1)C(O)P(=O)(O)CCC(N)C(O)=O |
| Formula: | C12H17N2O9P |
| M.Wt: | 364.247 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | LSP1-2111 is a potent, selective, and brain penetrant group III mGluRs agonist with EC50 of 2.2 and 1.7 uM for mGluR4 and mGluR6, respectively; displays 25-, and 30-fold preference over mGlu7 and mGlu8 receptors; selectively inhibits striatopallidal GABAergic transmission with no effect at a synapse modulated solely by the mGlu7 and mGlu8 receptors; counteracts haloperidol-induced catalepsy in experimental parkinson model. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
