| Cas No.: | 2173037-97-1 |
| Chemical Name: | (1S,2S,4S,5R,6S)-2-amino-4-[(3-methoxybenzene-1-carbonyl)amino]bicyclo[3.1.0]hexane-2,6-dicarboxylic acid |
| Synonyms: | LY2794193;(1S,2S,4S,5R,6S)-2-amino-4-[(3-methoxybenzene-1-carbonyl)amino]bicyclo[3.1.0]hexane-2,6-dicarboxylic acid;CWY;BDBM50244219;(1S,2S,4S,5R,6S)-2-amino-4-[(3-methoxybenzoyl)amino]bicyclo[3.1.0]hexane-2,6-dicarboxylic acid |
| SMILES: | OC([C@H]1[C@@H]2[C@H](C[C@@](C(=O)O)([C@@H]21)N)NC(C1C=CC=C(C=1)OC)=O)=O |
| Formula: | C16H18N2O6 |
| M.Wt: | 334.323924541473 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | LY2794193 is a highly potent and selective mGlu3 receptor agonist with Ki of 0.93 nM and EC50 of 47 nM, >100-fold selectivity over mGlu2 receptor. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
