| Cas No.: | 175340-20-2 |
| Chemical Name: | S 18986 |
| Synonyms: | S 18986;(3aS)-2,3,3a,4-tetrahydro-1H-pyrrolo[2,1-c][1,2,4]benzothiadiazine 5,5-dioxide;S-18986;(S)-2,3-dihydro-(3,4)cyclopentano-1,2,4-benzothiadiazine-1,1-dioxide;2,3,3a,4-tetrahydro-1H-pyrrolo[2,1-c][1,2,4]benzothiadiazine 5,5-dioxide;AC1LCV4Z;CHEMBL320642;DCL001120;S18986-1;SureCN6622911;1H-Pyrrolo[2,1-c][1,2,4]benzothiadiazine, 2,3,3a,4-tetrahydro-, 5,5-dioxide, (3aS)- |
| SMILES: | C1=CC=C2C(=C1)N3CCC[C@@H]3NS2(=O)=O |
| Formula: | C10H12N2O2S |
| M.Wt: | 224.27948 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | S-18986 is an orally bioavailable and BBB penetrant positive allosteric modulator of AMPA receptors; has nootropic and neuroprotective effects in animal studies, and induces both production of BDNF and AMPA-mediated release of noradrenaline and acetylcholine in the hippocampus and frontal cortex of the brain. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
