| Cas No.: | 1821638-40-7 |
| Chemical Name: | 2-[4-(2-Bromo-benzoyl)-phenoxy]-N-pyridin-3-yl-acetamide |
| Synonyms: | LUF7346;2-[4-(2-Bromo-benzoyl)-phenoxy]-N-pyridin-3-yl-acetamide;BDBM50499725;LUF7346, >=98% (HPLC);2-[4-(2-Bromobenzoyl)phenoxy]-N-(pyridin-3-yl)acetamide |
| SMILES: | BrC1C=CC=CC=1C(C1C=CC(=CC=1)OCC(NC1C=NC=CC=1)=O)=O |
| Formula: | C20H15BrN2O3 |
| M.Wt: | 411.248704195023 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | LUF7346 is a novel hERG allosteric modulator that slows IKr deactivation and positively shifting IKr inactivation; rescues the genetic form of LQTS, reverses drug-induced LQTS and correct thes combination of genetic and drug-induced LQTS; normalises both action- and field potentials (AP and FP, respectively) in all hPSC-CMs by slowing IKr deactivation and positively shifting the IKr inactivation. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
