| Cas No.: | 1029692-15-6 |
| Chemical Name: | LY2452473 |
| Synonyms: | LY-2452473;Isopropyl (2S)-7-Cyano-4-(pyridin-2-ylmethyl)-1,2,3,4-tetrah;Isopropyl (2S)-7-Cyano-4-(pyridin-2-ylmethyl)-1,2,3,4-tetrahydrocyclopenta[b]indol-2-ylcarbama;Isopropyl (2S)-7-Cyano-4-(pyridin-2-ylmethyl)-1,2,3,4-tetrahydrocyclopenta[b]indol-2-ylcarbamate;(S)-ISOPROPYL (7-CYANO-4-(PYRIDIN-2-YLMETHYL)-1,2,3,4-TETRAHYDROCYCLOPENTA[B]INDOL-2-YL)CARBAMATE;LY2452473;XKW9MYF94Y;isopropyl (S)-(7-cyano-4-(pyridin-2-ylmethyl)-1,2,3,4-tetrahydrocyclopenta[b]indol-2-yl)carbamate;DB12573;Carbamic acid, N-((2S)-7-cyano-1,2,3,4-tetrahydro-4 |
| SMILES: | O(C(C)C)C(N[C@H]1CC2C3C=C(C#N)C=CC=3N(CC3C=CC=CN=3)C=2C1)=O |
| Formula: | C22H22N4O2 |
| M.Wt: | 374.435684680939 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | LY2452473 (TT 701;OPK 88004) is an orally bioavailable selective androgen receptor modulator (SARM) being developed for the treatment of disorders related to hypogonadism; has the potential advantage of eliciting androgen receptor specificity and tissue selectivity to produce the beneficial effects of testosterone on bone, muscle, and improvements in erectile function over a PDE5i alone, with minimal steroid-related adverse effects.Prostate CancerPhase 2 Clinical |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
