| Cas No.: | 733035-26-2 |
| Chemical Name: | 4,6,8-trihydroxy-10-((2E,6E)-3,7,11-trimethyldodeca-2,6,10-trien-1-yl)-5H-dibenzo[b,e][1,4]diazepin-11(10H)-one |
| Synonyms: | TLN 4601;ECO-4601 |
| SMILES: | O=C1C2=CC=CC(O)=C2NC3=C(O)C=C(O)C=C3N1C/C=C(C)/CC/C=C(C)/CC/C=C(C)\C |
| Formula: | C28H34N2O4 |
| M.Wt: | 462.58 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Diazepinomicin (TLN 4601;ECO-4601) is a brain penetrant inhibitor of Ras-RAF-MAPK pathway post Ras prenylation and prior to MEK activation, binds the central and/or peripheral benzodiazepine receptors (PBR;TSPO); prevents EGF-induced phosphorylation of Raf-1, MEK, and ERK1/2; reduces Ras-GTP levels and induces apoptosis; shows antitumor activity and decreases tumor Raf-1 protein levels in MIA PaCa-2 tumor-bearing mice.Brain CancerPhase 2 Discontinued |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
